C23H37N3O2 — CID 18087679
2-[(4-ethylphenyl)methyl-methylamino]-N-[(1-morpholin-4-ylcyclohexyl)methyl]acetamide (PubChem CID 18087679) has the molecular formula C23H37N3O2 and a molecular weight of 387.57 g/mol. Its IUPAC name is 2-[(4-ethylphenyl)methyl-methylamino]-N-[(1-morpholin-4-ylcyclohexyl)methyl]acetamide.
| Compound Name | 2-[(4-ethylphenyl)methyl-methylamino]-N-[(1-morpholin-4-ylcyclohexyl)methyl]acetamide |
|---|---|
| PubChem CID | 18087679 |
| Molecular Formula | C23H37N3O2 |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.29 |
| IUPAC Name | 2-[(4-ethylphenyl)methyl-methylamino]-N-[(1-morpholin-4-ylcyclohexyl)methyl]acetamide |
| SMILES | CCc1ccc(CN(C)CC(=O)NCC2(N3CCOCC3)CCCCC2)cc1 |
| InChI | InChI=1S/C23H37N3O2/c1-3-20-7-9-21(10-8-20)17-25(2)18-22(27)24-19-23(11-5-4-6-12-23)26-13-15-28-16-14-26/h7-10H,3-6,11-19H2,1-2H3,(H,24,27) |
| InChIKey | JJVLGIMWOBDSJT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |