C19H36N4O3 — CID 55700066
2-[butyl-[2-[(1-morpholin-4-ylcyclohexyl)methylamino]-2-oxoethyl]amino]acetamide (PubChem CID 55700066) has the molecular formula C19H36N4O3 and a molecular weight of 368.52 g/mol. Its IUPAC name is 2-[butyl-[2-[(1-morpholin-4-ylcyclohexyl)methylamino]-2-oxoethyl]amino]acetamide.
| Compound Name | 2-[butyl-[2-[(1-morpholin-4-ylcyclohexyl)methylamino]-2-oxoethyl]amino]acetamide |
|---|---|
| PubChem CID | 55700066 |
| Molecular Formula | C19H36N4O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.28 |
| IUPAC Name | 2-[butyl-[2-[(1-morpholin-4-ylcyclohexyl)methylamino]-2-oxoethyl]amino]acetamide |
| SMILES | CCCCN(CC(N)=O)CC(=O)NCC1(N2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C19H36N4O3/c1-2-3-9-22(14-17(20)24)15-18(25)21-16-19(7-5-4-6-8-19)23-10-12-26-13-11-23/h2-16H2,1H3,(H2,20,24)(H,21,25) |
| InChIKey | NVYCQLBCKCRLFL-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |