C18H18N2O2S2 — CID 18093681
3-[2-oxo-2-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-1,3-thiazolidin-2-one (PubChem CID 18093681) has the molecular formula C18H18N2O2S2 and a molecular weight of 358.49 g/mol. Its IUPAC name is 3-[2-oxo-2-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-1,3-thiazolidin-2-one.
| Compound Name | 3-[2-oxo-2-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 18093681 |
| Molecular Formula | C18H18N2O2S2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 3-[2-oxo-2-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-1,3-thiazolidin-2-one |
| SMILES | O=C1SCCN1CC(=O)N1CCc2sccc2C1c1ccccc1 |
| InChI | InChI=1S/C18H18N2O2S2/c21-16(12-19-9-11-24-18(19)22)20-8-6-15-14(7-10-23-15)17(20)13-4-2-1-3-5-13/h1-5,7,10,17H,6,8-9,11-12H2 |
| InChIKey | BAGYTAXEGONSBD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|