About 4-[[(4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl-methylamino]methyl]-7-methylchromen-2-one
4-[[(4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl-methylamino]methyl]-7-methylchromen-2-one (PubChem CID 18094567) has the molecular formula C23H26N2O3
and a molecular weight of 378.47 g/mol. Its IUPAC name is 4-[[(4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl-methylamino]methyl]-7-methylchromen-2-one.
Molecular Properties
| Compound Name | 4-[[(4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl-methylamino]methyl]-7-methylchromen-2-one |
| PubChem CID | 18094567 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 4-[[(4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl-methylamino]methyl]-7-methylchromen-2-one |
| SMILES | CCN1CC(CN(C)Cc2cc(=O)oc3cc(C)ccc23)Oc2ccccc21 |
| InChI | InChI=1S/C23H26N2O3/c1-4-25-15-18(27-21-8-6-5-7-20(21)25)14-24(3)13-17-12-23(26)28-22-11-16(2)9-10-19(17)22/h5-12,18H,4,13-15H2,1-3H3 |
| InChIKey | IZQDZAHDMXBNJJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl-methylamino]methyl]-7-methylchromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl-methylamino]methyl]-7-methylchromen-2-one?
The IUPAC name of 4-[[(4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl-methylamino]methyl]-7-methylchromen-2-one (CID 18094567) is 4-[[(4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl-methylamino]methyl]-7-methylchromen-2-one.
What is the SMILES notation for 4-[[(4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl-methylamino]methyl]-7-methylchromen-2-one?
The canonical SMILES for 4-[[(4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl-methylamino]methyl]-7-methylchromen-2-one is CCN1CC(CN(C)Cc2cc(=O)oc3cc(C)ccc23)Oc2ccccc21.
What is the InChIKey of 4-[[(4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl-methylamino]methyl]-7-methylchromen-2-one?
The InChIKey is IZQDZAHDMXBNJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N2O3/c1-4-25-15-18(27-21-8-6-5-7-20(21)25)14-24(3)13-17-12-23(26)28-22-11-16(2)9-10-19(17)22/h5-12,18H,4,13-15H2,1-3H3.
What are the key properties of 4-[[(4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl-methylamino]methyl]-7-methylchromen-2-one?
4-[[(4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl-methylamino]methyl]-7-methylchromen-2-one has a molecular weight of 378.47 g/mol, XLogP of 3.82, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl-methylamino]methyl]-7-methylchromen-2-one is sourced from PubChem (CID 18094567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).