C18H21N3O2S — CID 18094910
N-(3-cyanothiophen-2-yl)-3-[methyl-[2-(4-methylphenoxy)ethyl]amino]propanamide (PubChem CID 18094910) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is N-(3-cyanothiophen-2-yl)-3-[methyl-[2-(4-methylphenoxy)ethyl]amino]propanamide.
| Compound Name | N-(3-cyanothiophen-2-yl)-3-[methyl-[2-(4-methylphenoxy)ethyl]amino]propanamide |
|---|---|
| PubChem CID | 18094910 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | N-(3-cyanothiophen-2-yl)-3-[methyl-[2-(4-methylphenoxy)ethyl]amino]propanamide |
| SMILES | Cc1ccc(OCCN(C)CCC(=O)Nc2sccc2C#N)cc1 |
| InChI | InChI=1S/C18H21N3O2S/c1-14-3-5-16(6-4-14)23-11-10-21(2)9-7-17(22)20-18-15(13-19)8-12-24-18/h3-6,8,12H,7,9-11H2,1-2H3,(H,20,22) |
| InChIKey | AQXNAHDYKHDEAW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |