C15H13FN4O2 — CID 18095479
N-[(2-fluorophenyl)methyl]-N-methyl-3-nitroimidazo[1,2-a]pyridin-2-amine (PubChem CID 18095479) has the molecular formula C15H13FN4O2 and a molecular weight of 300.29 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-N-methyl-3-nitroimidazo[1,2-a]pyridin-2-amine.
| Compound Name | N-[(2-fluorophenyl)methyl]-N-methyl-3-nitroimidazo[1,2-a]pyridin-2-amine |
|---|---|
| PubChem CID | 18095479 |
| Molecular Formula | C15H13FN4O2 |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-N-methyl-3-nitroimidazo[1,2-a]pyridin-2-amine |
| SMILES | CN(Cc1ccccc1F)c1nc2ccccn2c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H13FN4O2/c1-18(10-11-6-2-3-7-12(11)16)14-15(20(21)22)19-9-5-4-8-13(19)17-14/h2-9H,10H2,1H3 |
| InChIKey | ODLHGBWYYANMAQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|