C23H25N3O4 — CID 18112125
N-[(2,3-dimethoxyphenyl)methyl]-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-methyl-2-oxoacetamide (PubChem CID 18112125) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is N-[(2,3-dimethoxyphenyl)methyl]-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-methyl-2-oxoacetamide.
| Compound Name | N-[(2,3-dimethoxyphenyl)methyl]-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-methyl-2-oxoacetamide |
|---|---|
| PubChem CID | 18112125 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | N-[(2,3-dimethoxyphenyl)methyl]-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-methyl-2-oxoacetamide |
| SMILES | COc1cccc(CN(C)C(=O)C(=O)c2c(C)nn(-c3ccccc3)c2C)c1OC |
| InChI | InChI=1S/C23H25N3O4/c1-15-20(16(2)26(24-15)18-11-7-6-8-12-18)21(27)23(28)25(3)14-17-10-9-13-19(29-4)22(17)30-5/h6-13H,14H2,1-5H3 |
| InChIKey | VPMWWMMFBVQRLP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|