C21H19ClFN3O2 — CID 18112205
N-[(2-chloro-6-fluorophenyl)methyl]-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-methyl-2-oxoacetamide (PubChem CID 18112205) has the molecular formula C21H19ClFN3O2 and a molecular weight of 399.85 g/mol. Its IUPAC name is N-[(2-chloro-6-fluorophenyl)methyl]-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-methyl-2-oxoacetamide.
| Compound Name | N-[(2-chloro-6-fluorophenyl)methyl]-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-methyl-2-oxoacetamide |
|---|---|
| PubChem CID | 18112205 |
| Molecular Formula | C21H19ClFN3O2 |
| Molecular Weight | 399.85 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | N-[(2-chloro-6-fluorophenyl)methyl]-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-methyl-2-oxoacetamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C(=O)C(=O)N(C)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C21H19ClFN3O2/c1-13-19(14(2)26(24-13)15-8-5-4-6-9-15)20(27)21(28)25(3)12-16-17(22)10-7-11-18(16)23/h4-11H,12H2,1-3H3 |
| InChIKey | YTKSYQKCBZCIHT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.85 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|