C28H31N5O2 — CID 55814054
2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-methyl-2-oxo-N-[5-(3-phenyl-1H-pyrazol-5-yl)pentyl]acetamide (PubChem CID 55814054) has the molecular formula C28H31N5O2 and a molecular weight of 469.59 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-methyl-2-oxo-N-[5-(3-phenyl-1H-pyrazol-5-yl)pentyl]acetamide.
| Compound Name | 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-methyl-2-oxo-N-[5-(3-phenyl-1H-pyrazol-5-yl)pentyl]acetamide |
|---|---|
| PubChem CID | 55814054 |
| Molecular Formula | C28H31N5O2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-methyl-2-oxo-N-[5-(3-phenyl-1H-pyrazol-5-yl)pentyl]acetamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C(=O)C(=O)N(C)CCCCCc1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C28H31N5O2/c1-20-26(21(2)33(31-20)24-16-10-5-11-17-24)27(34)28(35)32(3)18-12-6-9-15-23-19-25(30-29-23)22-13-7-4-8-14-22/h4-5,7-8,10-11,13-14,16-17,19H,6,9,12,15,18H2,1-3H3,(H,29,30) |
| InChIKey | JJMCFPXGVPBZIB-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|