C25H27N7O3 — CID 55959382
N,5-dimethyl-1-(3-nitrophenyl)-N-[5-(3-phenyl-1H-pyrazol-5-yl)pentyl]triazole-4-carboxamide (PubChem CID 55959382) has the molecular formula C25H27N7O3 and a molecular weight of 473.54 g/mol. Its IUPAC name is N,5-dimethyl-1-(3-nitrophenyl)-N-[5-(3-phenyl-1H-pyrazol-5-yl)pentyl]triazole-4-carboxamide.
| Compound Name | N,5-dimethyl-1-(3-nitrophenyl)-N-[5-(3-phenyl-1H-pyrazol-5-yl)pentyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 55959382 |
| Molecular Formula | C25H27N7O3 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | N,5-dimethyl-1-(3-nitrophenyl)-N-[5-(3-phenyl-1H-pyrazol-5-yl)pentyl]triazole-4-carboxamide |
| SMILES | Cc1c(C(=O)N(C)CCCCCc2cc(-c3ccccc3)n[nH]2)nnn1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H27N7O3/c1-18-24(28-29-31(18)21-13-9-14-22(17-21)32(34)35)25(33)30(2)15-8-4-7-12-20-16-23(27-26-20)19-10-5-3-6-11-19/h3,5-6,9-11,13-14,16-17H,4,7-8,12,15H2,1-2H3,(H,26,27) |
| InChIKey | KYICSAXKBIWVEI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 122.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|