C22H27ClN4O — CID 119737086
4-amino-N-methyl-N-[5-(3-phenyl-1H-pyrazol-5-yl)pentyl]benzamide;hydrochloride (PubChem CID 119737086) has the molecular formula C22H27ClN4O and a molecular weight of 398.94 g/mol. Its IUPAC name is 4-amino-N-methyl-N-[5-(3-phenyl-1H-pyrazol-5-yl)pentyl]benzamide;hydrochloride.
| Compound Name | 4-amino-N-methyl-N-[5-(3-phenyl-1H-pyrazol-5-yl)pentyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119737086 |
| Molecular Formula | C22H27ClN4O |
| Molecular Weight | 398.94 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 4-amino-N-methyl-N-[5-(3-phenyl-1H-pyrazol-5-yl)pentyl]benzamide;hydrochloride |
| SMILES | CN(CCCCCc1cc(-c2ccccc2)n[nH]1)C(=O)c1ccc(N)cc1.Cl |
| InChI | InChI=1S/C22H26N4O.ClH/c1-26(22(27)18-11-13-19(23)14-12-18)15-7-3-6-10-20-16-21(25-24-20)17-8-4-2-5-9-17;/h2,4-5,8-9,11-14,16H,3,6-7,10,15,23H2,1H3,(H,24,25);1H |
| InChIKey | PRPNCCOZTQJQIP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.94 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|