C21H31ClN4O — CID 119737084
3-amino-N-methyl-N-[5-(3-phenyl-1H-pyrazol-5-yl)pentyl]cyclopentane-1-carboxamide;hydrochloride (PubChem CID 119737084) has the molecular formula C21H31ClN4O and a molecular weight of 390.96 g/mol. Its IUPAC name is 3-amino-N-methyl-N-[5-(3-phenyl-1H-pyrazol-5-yl)pentyl]cyclopentane-1-carboxamide;hydrochloride.
| Compound Name | 3-amino-N-methyl-N-[5-(3-phenyl-1H-pyrazol-5-yl)pentyl]cyclopentane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119737084 |
| Molecular Formula | C21H31ClN4O |
| Molecular Weight | 390.96 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 3-amino-N-methyl-N-[5-(3-phenyl-1H-pyrazol-5-yl)pentyl]cyclopentane-1-carboxamide;hydrochloride |
| SMILES | CN(CCCCCc1cc(-c2ccccc2)n[nH]1)C(=O)C1CCC(N)C1.Cl |
| InChI | InChI=1S/C21H30N4O.ClH/c1-25(21(26)17-11-12-18(22)14-17)13-7-3-6-10-19-15-20(24-23-19)16-8-4-2-5-9-16;/h2,4-5,8-9,15,17-18H,3,6-7,10-14,22H2,1H3,(H,23,24);1H |
| InChIKey | FEZMQEGQGRRWCO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.96 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|