C21H29FN4O — CID 119301819
N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methylpiperidine-3-carboxamide (PubChem CID 119301819) has the molecular formula C21H29FN4O and a molecular weight of 372.49 g/mol. Its IUPAC name is N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methylpiperidine-3-carboxamide.
| Compound Name | N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 119301819 |
| Molecular Formula | C21H29FN4O |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methylpiperidine-3-carboxamide |
| SMILES | CN(CCCCCc1cc(-c2cccc(F)c2)n[nH]1)C(=O)C1CCCNC1 |
| InChI | InChI=1S/C21H29FN4O/c1-26(21(27)17-8-6-11-23-15-17)12-4-2-3-10-19-14-20(25-24-19)16-7-5-9-18(22)13-16/h5,7,9,13-14,17,23H,2-4,6,8,10-12,15H2,1H3,(H,24,25) |
| InChIKey | DLMDKCVYADSVCM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|