C22H31FN4O3S — CID 55978255
N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methyl-1-methylsulfonylpiperidine-3-carboxamide (PubChem CID 55978255) has the molecular formula C22H31FN4O3S and a molecular weight of 450.58 g/mol. Its IUPAC name is N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methyl-1-methylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methyl-1-methylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 55978255 |
| Molecular Formula | C22H31FN4O3S |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methyl-1-methylsulfonylpiperidine-3-carboxamide |
| SMILES | CN(CCCCCc1cc(-c2cccc(F)c2)n[nH]1)C(=O)C1CCCN(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C22H31FN4O3S/c1-26(22(28)18-9-7-13-27(16-18)31(2,29)30)12-5-3-4-11-20-15-21(25-24-20)17-8-6-10-19(23)14-17/h6,8,10,14-15,18H,3-5,7,9,11-13,16H2,1-2H3,(H,24,25) |
| InChIKey | ZOEYXAFWCZDZAY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|