C21H28FN3O3S2 — CID 55977873
2-(1,1-dioxothiolan-3-yl)sulfanyl-N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methylacetamide (PubChem CID 55977873) has the molecular formula C21H28FN3O3S2 and a molecular weight of 453.61 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)sulfanyl-N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methylacetamide.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)sulfanyl-N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methylacetamide |
|---|---|
| PubChem CID | 55977873 |
| Molecular Formula | C21H28FN3O3S2 |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)sulfanyl-N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methylacetamide |
| SMILES | CN(CCCCCc1cc(-c2cccc(F)c2)n[nH]1)C(=O)CSC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H28FN3O3S2/c1-25(21(26)14-29-19-9-11-30(27,28)15-19)10-4-2-3-8-18-13-20(24-23-18)16-6-5-7-17(22)12-16/h5-7,12-13,19H,2-4,8-11,14-15H2,1H3,(H,23,24) |
| InChIKey | YFVPIXMNJGLJEH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|