C21H25FN4OS — CID 55975799
N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methyl-2-(2-methyl-1,3-thiazol-4-yl)acetamide (PubChem CID 55975799) has the molecular formula C21H25FN4OS and a molecular weight of 400.52 g/mol. Its IUPAC name is N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methyl-2-(2-methyl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methyl-2-(2-methyl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 55975799 |
| Molecular Formula | C21H25FN4OS |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methyl-2-(2-methyl-1,3-thiazol-4-yl)acetamide |
| SMILES | Cc1nc(CC(=O)N(C)CCCCCc2cc(-c3cccc(F)c3)n[nH]2)cs1 |
| InChI | InChI=1S/C21H25FN4OS/c1-15-23-19(14-28-15)13-21(27)26(2)10-5-3-4-9-18-12-20(25-24-18)16-7-6-8-17(22)11-16/h6-8,11-12,14H,3-5,9-10,13H2,1-2H3,(H,24,25) |
| InChIKey | JPHYFSGCVYWGCM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|