C23H27FN4O3S — CID 55975551
N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methyl-4-(methylsulfamoyl)benzamide (PubChem CID 55975551) has the molecular formula C23H27FN4O3S and a molecular weight of 458.56 g/mol. Its IUPAC name is N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methyl-4-(methylsulfamoyl)benzamide.
| Compound Name | N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methyl-4-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55975551 |
| Molecular Formula | C23H27FN4O3S |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methyl-4-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)c1ccc(C(=O)N(C)CCCCCc2cc(-c3cccc(F)c3)n[nH]2)cc1 |
| InChI | InChI=1S/C23H27FN4O3S/c1-25-32(30,31)21-12-10-17(11-13-21)23(29)28(2)14-5-3-4-9-20-16-22(27-26-20)18-7-6-8-19(24)15-18/h6-8,10-13,15-16,25H,3-5,9,14H2,1-2H3,(H,26,27) |
| InChIKey | LOWZSNDLASJBSA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|