C25H29FN4O2 — CID 55976193
N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methyl-3-(propanoylamino)benzamide (PubChem CID 55976193) has the molecular formula C25H29FN4O2 and a molecular weight of 436.53 g/mol. Its IUPAC name is N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methyl-3-(propanoylamino)benzamide.
| Compound Name | N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methyl-3-(propanoylamino)benzamide |
|---|---|
| PubChem CID | 55976193 |
| Molecular Formula | C25H29FN4O2 |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methyl-3-(propanoylamino)benzamide |
| SMILES | CCC(=O)Nc1cccc(C(=O)N(C)CCCCCc2cc(-c3cccc(F)c3)n[nH]2)c1 |
| InChI | InChI=1S/C25H29FN4O2/c1-3-24(31)27-21-13-8-10-19(16-21)25(32)30(2)14-6-4-5-12-22-17-23(29-28-22)18-9-7-11-20(26)15-18/h7-11,13,15-17H,3-6,12,14H2,1-2H3,(H,27,31)(H,28,29) |
| InChIKey | FBUIJEGDSJBTRL-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|