C28H29FN4O2 — CID 55976835
N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methyl-3-(pyridin-3-ylmethoxy)benzamide (PubChem CID 55976835) has the molecular formula C28H29FN4O2 and a molecular weight of 472.56 g/mol. Its IUPAC name is N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methyl-3-(pyridin-3-ylmethoxy)benzamide.
| Compound Name | N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methyl-3-(pyridin-3-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 55976835 |
| Molecular Formula | C28H29FN4O2 |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methyl-3-(pyridin-3-ylmethoxy)benzamide |
| SMILES | CN(CCCCCc1cc(-c2cccc(F)c2)n[nH]1)C(=O)c1cccc(OCc2cccnc2)c1 |
| InChI | InChI=1S/C28H29FN4O2/c1-33(28(34)23-10-6-13-26(17-23)35-20-21-8-7-14-30-19-21)15-4-2-3-12-25-18-27(32-31-25)22-9-5-11-24(29)16-22/h5-11,13-14,16-19H,2-4,12,15,20H2,1H3,(H,31,32) |
| InChIKey | YSYYQQQDBLMGBH-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|