C24H29FN4O3S — CID 55863145
3-(dimethylsulfamoyl)-N-[5-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methylbenzamide (PubChem CID 55863145) has the molecular formula C24H29FN4O3S and a molecular weight of 472.59 g/mol. Its IUPAC name is 3-(dimethylsulfamoyl)-N-[5-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methylbenzamide.
| Compound Name | 3-(dimethylsulfamoyl)-N-[5-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 55863145 |
| Molecular Formula | C24H29FN4O3S |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 3-(dimethylsulfamoyl)-N-[5-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methylbenzamide |
| SMILES | CN(CCCCCc1cc(-c2ccc(F)cc2)n[nH]1)C(=O)c1cccc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C24H29FN4O3S/c1-28(2)33(31,32)22-10-7-8-19(16-22)24(30)29(3)15-6-4-5-9-21-17-23(27-26-21)18-11-13-20(25)14-12-18/h7-8,10-14,16-17H,4-6,9,15H2,1-3H3,(H,26,27) |
| InChIKey | QZOVTMUFVMGOOF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|