C26H29FN4O2 — CID 52692656
1-acetyl-N-[5-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methyl-2,3-dihydroindole-5-carboxamide (PubChem CID 52692656) has the molecular formula C26H29FN4O2 and a molecular weight of 448.54 g/mol. Its IUPAC name is 1-acetyl-N-[5-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methyl-2,3-dihydroindole-5-carboxamide.
| Compound Name | 1-acetyl-N-[5-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methyl-2,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 52692656 |
| Molecular Formula | C26H29FN4O2 |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | 1-acetyl-N-[5-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methyl-2,3-dihydroindole-5-carboxamide |
| SMILES | CC(=O)N1CCc2cc(C(=O)N(C)CCCCCc3cc(-c4ccc(F)cc4)n[nH]3)ccc21 |
| InChI | InChI=1S/C26H29FN4O2/c1-18(32)31-15-13-20-16-21(9-12-25(20)31)26(33)30(2)14-5-3-4-6-23-17-24(29-28-23)19-7-10-22(27)11-8-19/h7-12,16-17H,3-6,13-15H2,1-2H3,(H,28,29) |
| InChIKey | UTEJLCYCUCBBOB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|