C19H25FN4O3 — CID 122019002
3-[[5-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]pentyl-methylcarbamoyl]amino]propanoic acid (PubChem CID 122019002) has the molecular formula C19H25FN4O3 and a molecular weight of 376.43 g/mol. Its IUPAC name is 3-[[5-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]pentyl-methylcarbamoyl]amino]propanoic acid.
| Compound Name | 3-[[5-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]pentyl-methylcarbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122019002 |
| Molecular Formula | C19H25FN4O3 |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 3-[[5-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]pentyl-methylcarbamoyl]amino]propanoic acid |
| SMILES | CN(CCCCCc1cc(-c2ccc(F)cc2)n[nH]1)C(=O)NCCC(=O)O |
| InChI | InChI=1S/C19H25FN4O3/c1-24(19(27)21-11-10-18(25)26)12-4-2-3-5-16-13-17(23-22-16)14-6-8-15(20)9-7-14/h6-9,13H,2-5,10-12H2,1H3,(H,21,27)(H,22,23)(H,25,26) |
| InChIKey | IZJSAGQCKAFELZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|