C23H27FN4O — CID 51127515
1-[5-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-1-methyl-3-(4-methylphenyl)urea (PubChem CID 51127515) has the molecular formula C23H27FN4O and a molecular weight of 394.49 g/mol. Its IUPAC name is 1-[5-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-1-methyl-3-(4-methylphenyl)urea.
| Compound Name | 1-[5-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-1-methyl-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 51127515 |
| Molecular Formula | C23H27FN4O |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | 1-[5-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-1-methyl-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)N(C)CCCCCc2cc(-c3ccc(F)cc3)n[nH]2)cc1 |
| InChI | InChI=1S/C23H27FN4O/c1-17-7-13-20(14-8-17)25-23(29)28(2)15-5-3-4-6-21-16-22(27-26-21)18-9-11-19(24)12-10-18/h7-14,16H,3-6,15H2,1-2H3,(H,25,29)(H,26,27) |
| InChIKey | DIBGWKJUDVJIIU-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|