C26H32FN3O3 — CID 55863273
3-(2,3-dimethoxyphenyl)-N-[5-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methylpropanamide (PubChem CID 55863273) has the molecular formula C26H32FN3O3 and a molecular weight of 453.56 g/mol. Its IUPAC name is 3-(2,3-dimethoxyphenyl)-N-[5-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methylpropanamide.
| Compound Name | 3-(2,3-dimethoxyphenyl)-N-[5-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 55863273 |
| Molecular Formula | C26H32FN3O3 |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 3-(2,3-dimethoxyphenyl)-N-[5-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methylpropanamide |
| SMILES | COc1cccc(CCC(=O)N(C)CCCCCc2cc(-c3ccc(F)cc3)n[nH]2)c1OC |
| InChI | InChI=1S/C26H32FN3O3/c1-30(25(31)16-13-20-8-7-10-24(32-2)26(20)33-3)17-6-4-5-9-22-18-23(29-28-22)19-11-14-21(27)15-12-19/h7-8,10-12,14-15,18H,4-6,9,13,16-17H2,1-3H3,(H,28,29) |
| InChIKey | UOHLCEOCBVQJHO-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|