C25H31N3O2 — CID 55960147
3-(2-methoxyphenyl)-N-methyl-N-[5-(3-phenyl-1H-pyrazol-5-yl)pentyl]propanamide (PubChem CID 55960147) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-N-methyl-N-[5-(3-phenyl-1H-pyrazol-5-yl)pentyl]propanamide.
| Compound Name | 3-(2-methoxyphenyl)-N-methyl-N-[5-(3-phenyl-1H-pyrazol-5-yl)pentyl]propanamide |
|---|---|
| PubChem CID | 55960147 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 3-(2-methoxyphenyl)-N-methyl-N-[5-(3-phenyl-1H-pyrazol-5-yl)pentyl]propanamide |
| SMILES | COc1ccccc1CCC(=O)N(C)CCCCCc1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C25H31N3O2/c1-28(25(29)17-16-21-13-8-9-15-24(21)30-2)18-10-4-7-14-22-19-23(27-26-22)20-11-5-3-6-12-20/h3,5-6,8-9,11-13,15,19H,4,7,10,14,16-18H2,1-2H3,(H,26,27) |
| InChIKey | NKRDMLQNABPYDR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|