C23H28N4O3S — CID 56553208
N-methyl-N-[5-(3-phenyl-1H-pyrazol-5-yl)pentyl]-2-(4-sulfamoylphenyl)acetamide (PubChem CID 56553208) has the molecular formula C23H28N4O3S and a molecular weight of 440.57 g/mol. Its IUPAC name is N-methyl-N-[5-(3-phenyl-1H-pyrazol-5-yl)pentyl]-2-(4-sulfamoylphenyl)acetamide.
| Compound Name | N-methyl-N-[5-(3-phenyl-1H-pyrazol-5-yl)pentyl]-2-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 56553208 |
| Molecular Formula | C23H28N4O3S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | N-methyl-N-[5-(3-phenyl-1H-pyrazol-5-yl)pentyl]-2-(4-sulfamoylphenyl)acetamide |
| SMILES | CN(CCCCCc1cc(-c2ccccc2)n[nH]1)C(=O)Cc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C23H28N4O3S/c1-27(23(28)16-18-11-13-21(14-12-18)31(24,29)30)15-7-3-6-10-20-17-22(26-25-20)19-8-4-2-5-9-19/h2,4-5,8-9,11-14,17H,3,6-7,10,15-16H2,1H3,(H,25,26)(H2,24,29,30) |
| InChIKey | YZNCFCVDLXLELO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 109.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|