C24H27ClN4O2 — CID 55961175
3-chloro-N-[2-[methyl-[5-(3-phenyl-1H-pyrazol-5-yl)pentyl]amino]-2-oxoethyl]benzamide (PubChem CID 55961175) has the molecular formula C24H27ClN4O2 and a molecular weight of 438.96 g/mol. Its IUPAC name is 3-chloro-N-[2-[methyl-[5-(3-phenyl-1H-pyrazol-5-yl)pentyl]amino]-2-oxoethyl]benzamide.
| Compound Name | 3-chloro-N-[2-[methyl-[5-(3-phenyl-1H-pyrazol-5-yl)pentyl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 55961175 |
| Molecular Formula | C24H27ClN4O2 |
| Molecular Weight | 438.96 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 3-chloro-N-[2-[methyl-[5-(3-phenyl-1H-pyrazol-5-yl)pentyl]amino]-2-oxoethyl]benzamide |
| SMILES | CN(CCCCCc1cc(-c2ccccc2)n[nH]1)C(=O)CNC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C24H27ClN4O2/c1-29(23(30)17-26-24(31)19-11-8-12-20(25)15-19)14-7-3-6-13-21-16-22(28-27-21)18-9-4-2-5-10-18/h2,4-5,8-12,15-16H,3,6-7,13-14,17H2,1H3,(H,26,31)(H,27,28) |
| InChIKey | RAQILPQJLFVPJH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.96 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|