C26H29N5O2 — CID 56577930
N'-(2-cyanoethyl)-N-methyl-N'-phenyl-N-[3-(3-phenyl-1H-pyrazol-5-yl)propyl]butanediamide (PubChem CID 56577930) has the molecular formula C26H29N5O2 and a molecular weight of 443.55 g/mol. Its IUPAC name is N'-(2-cyanoethyl)-N-methyl-N'-phenyl-N-[3-(3-phenyl-1H-pyrazol-5-yl)propyl]butanediamide.
| Compound Name | N'-(2-cyanoethyl)-N-methyl-N'-phenyl-N-[3-(3-phenyl-1H-pyrazol-5-yl)propyl]butanediamide |
|---|---|
| PubChem CID | 56577930 |
| Molecular Formula | C26H29N5O2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | N'-(2-cyanoethyl)-N-methyl-N'-phenyl-N-[3-(3-phenyl-1H-pyrazol-5-yl)propyl]butanediamide |
| SMILES | CN(CCCc1cc(-c2ccccc2)n[nH]1)C(=O)CCC(=O)N(CCC#N)c1ccccc1 |
| InChI | InChI=1S/C26H29N5O2/c1-30(18-8-12-22-20-24(29-28-22)21-10-4-2-5-11-21)25(32)15-16-26(33)31(19-9-17-27)23-13-6-3-7-14-23/h2-7,10-11,13-14,20H,8-9,12,15-16,18-19H2,1H3,(H,28,29) |
| InChIKey | YRIJQQZCAIAGNE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |