C24H29N3O3 — CID 56577605
N'-(2-cyanoethyl)-N-methyl-N-[3-(2-methylphenoxy)propyl]-N'-phenylbutanediamide (PubChem CID 56577605) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is N'-(2-cyanoethyl)-N-methyl-N-[3-(2-methylphenoxy)propyl]-N'-phenylbutanediamide.
| Compound Name | N'-(2-cyanoethyl)-N-methyl-N-[3-(2-methylphenoxy)propyl]-N'-phenylbutanediamide |
|---|---|
| PubChem CID | 56577605 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | N'-(2-cyanoethyl)-N-methyl-N-[3-(2-methylphenoxy)propyl]-N'-phenylbutanediamide |
| SMILES | Cc1ccccc1OCCCN(C)C(=O)CCC(=O)N(CCC#N)c1ccccc1 |
| InChI | InChI=1S/C24H29N3O3/c1-20-10-6-7-13-22(20)30-19-9-17-26(2)23(28)14-15-24(29)27(18-8-16-25)21-11-4-3-5-12-21/h3-7,10-13H,8-9,14-15,17-19H2,1-2H3 |
| InChIKey | DHZYXJIXVVYUHB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|