C22H26FN3O4S2 — CID 55986241
N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methyl-4-methylsulfonylbenzenesulfonamide (PubChem CID 55986241) has the molecular formula C22H26FN3O4S2 and a molecular weight of 479.60 g/mol. Its IUPAC name is N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methyl-4-methylsulfonylbenzenesulfonamide.
| Compound Name | N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methyl-4-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 55986241 |
| Molecular Formula | C22H26FN3O4S2 |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methyl-4-methylsulfonylbenzenesulfonamide |
| SMILES | CN(CCCCCc1cc(-c2cccc(F)c2)n[nH]1)S(=O)(=O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C22H26FN3O4S2/c1-26(32(29,30)21-12-10-20(11-13-21)31(2,27)28)14-5-3-4-9-19-16-22(25-24-19)17-7-6-8-18(23)15-17/h6-8,10-13,15-16H,3-5,9,14H2,1-2H3,(H,24,25) |
| InChIKey | NPJYEWNMPMFRFB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 100.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|