C20H28ClFN4O2 — CID 119746043
N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methylmorpholine-3-carboxamide;hydrochloride (PubChem CID 119746043) has the molecular formula C20H28ClFN4O2 and a molecular weight of 410.92 g/mol. Its IUPAC name is N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methylmorpholine-3-carboxamide;hydrochloride.
| Compound Name | N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methylmorpholine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119746043 |
| Molecular Formula | C20H28ClFN4O2 |
| Molecular Weight | 410.92 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methylmorpholine-3-carboxamide;hydrochloride |
| SMILES | CN(CCCCCc1cc(-c2cccc(F)c2)n[nH]1)C(=O)C1COCCN1.Cl |
| InChI | InChI=1S/C20H27FN4O2.ClH/c1-25(20(26)19-14-27-11-9-22-19)10-4-2-3-8-17-13-18(24-23-17)15-6-5-7-16(21)12-15;/h5-7,12-13,19,22H,2-4,8-11,14H2,1H3,(H,23,24);1H |
| InChIKey | RIOIOEGONMNFDW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.92 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|