C26H33FN6O — CID 55994752
1-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-1-methyl-3-(1-pyridin-2-ylpiperidin-4-yl)urea (PubChem CID 55994752) has the molecular formula C26H33FN6O and a molecular weight of 464.59 g/mol. Its IUPAC name is 1-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-1-methyl-3-(1-pyridin-2-ylpiperidin-4-yl)urea.
| Compound Name | 1-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-1-methyl-3-(1-pyridin-2-ylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 55994752 |
| Molecular Formula | C26H33FN6O |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | 1-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-1-methyl-3-(1-pyridin-2-ylpiperidin-4-yl)urea |
| SMILES | CN(CCCCCc1cc(-c2cccc(F)c2)n[nH]1)C(=O)NC1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C26H33FN6O/c1-32(26(34)29-22-12-16-33(17-13-22)25-11-4-5-14-28-25)15-6-2-3-10-23-19-24(31-30-23)20-8-7-9-21(27)18-20/h4-5,7-9,11,14,18-19,22H,2-3,6,10,12-13,15-17H2,1H3,(H,29,34)(H,30,31) |
| InChIKey | YAHWPTPRDRHXSM-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|