C24H26FN5O — CID 55994231
1-[3-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]propyl]-3-[2-(1H-indol-3-yl)ethyl]-1-methylurea (PubChem CID 55994231) has the molecular formula C24H26FN5O and a molecular weight of 419.50 g/mol. Its IUPAC name is 1-[3-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]propyl]-3-[2-(1H-indol-3-yl)ethyl]-1-methylurea.
| Compound Name | 1-[3-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]propyl]-3-[2-(1H-indol-3-yl)ethyl]-1-methylurea |
|---|---|
| PubChem CID | 55994231 |
| Molecular Formula | C24H26FN5O |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 1-[3-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]propyl]-3-[2-(1H-indol-3-yl)ethyl]-1-methylurea |
| SMILES | CN(CCCc1cc(-c2cccc(F)c2)n[nH]1)C(=O)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C24H26FN5O/c1-30(24(31)26-12-11-18-16-27-22-10-3-2-9-21(18)22)13-5-8-20-15-23(29-28-20)17-6-4-7-19(25)14-17/h2-4,6-7,9-10,14-16,27H,5,8,11-13H2,1H3,(H,26,31)(H,28,29) |
| InChIKey | YCGRHJGSUHWZJX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 76.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |