C17H15ClN4O3 — CID 18116687
4-chloro-N-[(1-ethylbenzimidazol-2-yl)methyl]-2-nitrobenzamide (PubChem CID 18116687) has the molecular formula C17H15ClN4O3 and a molecular weight of 358.79 g/mol. Its IUPAC name is 4-chloro-N-[(1-ethylbenzimidazol-2-yl)methyl]-2-nitrobenzamide.
| Compound Name | 4-chloro-N-[(1-ethylbenzimidazol-2-yl)methyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 18116687 |
| Molecular Formula | C17H15ClN4O3 |
| Molecular Weight | 358.79 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 4-chloro-N-[(1-ethylbenzimidazol-2-yl)methyl]-2-nitrobenzamide |
| SMILES | CCn1c(CNC(=O)c2ccc(Cl)cc2[N+](=O)[O-])nc2ccccc21 |
| InChI | InChI=1S/C17H15ClN4O3/c1-2-21-14-6-4-3-5-13(14)20-16(21)10-19-17(23)12-8-7-11(18)9-15(12)22(24)25/h3-9H,2,10H2,1H3,(H,19,23) |
| InChIKey | BZJQLXGOMXUHQT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.79 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|