C20H19N7O3 — CID 55515886
N-[(1-ethylbenzimidazol-2-yl)methyl]-5-methyl-1-(3-nitrophenyl)triazole-4-carboxamide (PubChem CID 55515886) has the molecular formula C20H19N7O3 and a molecular weight of 405.42 g/mol. Its IUPAC name is N-[(1-ethylbenzimidazol-2-yl)methyl]-5-methyl-1-(3-nitrophenyl)triazole-4-carboxamide.
| Compound Name | N-[(1-ethylbenzimidazol-2-yl)methyl]-5-methyl-1-(3-nitrophenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 55515886 |
| Molecular Formula | C20H19N7O3 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | N-[(1-ethylbenzimidazol-2-yl)methyl]-5-methyl-1-(3-nitrophenyl)triazole-4-carboxamide |
| SMILES | CCn1c(CNC(=O)c2nnn(-c3cccc([N+](=O)[O-])c3)c2C)nc2ccccc21 |
| InChI | InChI=1S/C20H19N7O3/c1-3-25-17-10-5-4-9-16(17)22-18(25)12-21-20(28)19-13(2)26(24-23-19)14-7-6-8-15(11-14)27(29)30/h4-11H,3,12H2,1-2H3,(H,21,28) |
| InChIKey | LBCIUCZMTORGNF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|