C18H14N8O4 — CID 78839171
5-methyl-1-(3-nitrophenyl)-N-[(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methyl]triazole-4-carboxamide (PubChem CID 78839171) has the molecular formula C18H14N8O4 and a molecular weight of 406.36 g/mol. Its IUPAC name is 5-methyl-1-(3-nitrophenyl)-N-[(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methyl]triazole-4-carboxamide.
| Compound Name | 5-methyl-1-(3-nitrophenyl)-N-[(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 78839171 |
| Molecular Formula | C18H14N8O4 |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 5-methyl-1-(3-nitrophenyl)-N-[(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methyl]triazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCc2nc(-c3ccncc3)no2)nnn1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H14N8O4/c1-11-16(22-24-25(11)13-3-2-4-14(9-13)26(28)29)18(27)20-10-15-21-17(23-30-15)12-5-7-19-8-6-12/h2-9H,10H2,1H3,(H,20,27) |
| InChIKey | FQIDVTPSVRJZDF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 154.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|