C17H27N3O4S — CID 18118530
N-[2-(tert-butylamino)-2-oxoethyl]-4-(tert-butylsulfamoyl)benzamide (PubChem CID 18118530) has the molecular formula C17H27N3O4S and a molecular weight of 369.49 g/mol. Its IUPAC name is N-[2-(tert-butylamino)-2-oxoethyl]-4-(tert-butylsulfamoyl)benzamide.
| Compound Name | N-[2-(tert-butylamino)-2-oxoethyl]-4-(tert-butylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 18118530 |
| Molecular Formula | C17H27N3O4S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | N-[2-(tert-butylamino)-2-oxoethyl]-4-(tert-butylsulfamoyl)benzamide |
| SMILES | CC(C)(C)NC(=O)CNC(=O)c1ccc(S(=O)(=O)NC(C)(C)C)cc1 |
| InChI | InChI=1S/C17H27N3O4S/c1-16(2,3)19-14(21)11-18-15(22)12-7-9-13(10-8-12)25(23,24)20-17(4,5)6/h7-10,20H,11H2,1-6H3,(H,18,22)(H,19,21) |
| InChIKey | DWWLMANBTFTDPU-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |