C16H13ClF4N2O2 — CID 18118827
2-[3-chloro-2-oxo-5-(trifluoromethyl)-1-pyridinyl]-N-[2-(3-fluorophenyl)ethyl]acetamide (PubChem CID 18118827) has the molecular formula C16H13ClF4N2O2 and a molecular weight of 376.74 g/mol. Its IUPAC name is 2-[3-chloro-2-oxo-5-(trifluoromethyl)-1-pyridinyl]-N-[2-(3-fluorophenyl)ethyl]acetamide.
| Compound Name | 2-[3-chloro-2-oxo-5-(trifluoromethyl)-1-pyridinyl]-N-[2-(3-fluorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 18118827 |
| Molecular Formula | C16H13ClF4N2O2 |
| Molecular Weight | 376.74 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 2-[3-chloro-2-oxo-5-(trifluoromethyl)-1-pyridinyl]-N-[2-(3-fluorophenyl)ethyl]acetamide |
| SMILES | O=C(Cn1cc(C(F)(F)F)cc(Cl)c1=O)NCCc1cccc(F)c1 |
| InChI | InChI=1S/C16H13ClF4N2O2/c17-13-7-11(16(19,20)21)8-23(15(13)25)9-14(24)22-5-4-10-2-1-3-12(18)6-10/h1-3,6-8H,4-5,9H2,(H,22,24) |
| InChIKey | CYDWWDSEODXBKX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.74 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |