C21H27N5O3 — CID 18120796
4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[2-(2-methylbenzimidazol-1-yl)ethyl]butanamide (PubChem CID 18120796) has the molecular formula C21H27N5O3 and a molecular weight of 397.48 g/mol. Its IUPAC name is 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[2-(2-methylbenzimidazol-1-yl)ethyl]butanamide.
| Compound Name | 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[2-(2-methylbenzimidazol-1-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 18120796 |
| Molecular Formula | C21H27N5O3 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[2-(2-methylbenzimidazol-1-yl)ethyl]butanamide |
| SMILES | Cc1nc2ccccc2n1CCNC(=O)CCCN1C(=O)NC2(CCCC2)C1=O |
| InChI | InChI=1S/C21H27N5O3/c1-15-23-16-7-2-3-8-17(16)25(15)14-12-22-18(27)9-6-13-26-19(28)21(24-20(26)29)10-4-5-11-21/h2-3,7-8H,4-6,9-14H2,1H3,(H,22,27)(H,24,29) |
| InChIKey | LMYDUHARQJVDCW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|