C26H25N5O3 — CID 40791005
N-[2-(2-methylbenzimidazol-1-yl)ethyl]-2-[(4R)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 40791005) has the molecular formula C26H25N5O3 and a molecular weight of 455.52 g/mol. Its IUPAC name is N-[2-(2-methylbenzimidazol-1-yl)ethyl]-2-[(4R)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[2-(2-methylbenzimidazol-1-yl)ethyl]-2-[(4R)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 40791005 |
| Molecular Formula | C26H25N5O3 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | N-[2-(2-methylbenzimidazol-1-yl)ethyl]-2-[(4R)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | Cc1nc2ccccc2n1CCNC(=O)CN1C(=O)N[C@](C)(c2ccc3ccccc3c2)C1=O |
| InChI | InChI=1S/C26H25N5O3/c1-17-28-21-9-5-6-10-22(21)30(17)14-13-27-23(32)16-31-24(33)26(2,29-25(31)34)20-12-11-18-7-3-4-8-19(18)15-20/h3-12,15H,13-14,16H2,1-2H3,(H,27,32)(H,29,34)/t26-/m1/s1 |
| InChIKey | IOFGRIBLBUVXFC-AREMUKBSSA-N |
| XLogP | 3.08 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|