C18H24ClN3O2S — CID 18121098
N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide (PubChem CID 18121098) has the molecular formula C18H24ClN3O2S and a molecular weight of 381.93 g/mol. Its IUPAC name is N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide.
| Compound Name | N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide |
|---|---|
| PubChem CID | 18121098 |
| Molecular Formula | C18H24ClN3O2S |
| Molecular Weight | 381.93 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide |
| SMILES | O=C(CCN1CCSC1=O)NC1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C18H24ClN3O2S/c19-15-3-1-14(2-4-15)13-21-8-5-16(6-9-21)20-17(23)7-10-22-11-12-25-18(22)24/h1-4,16H,5-13H2,(H,20,23) |
| InChIKey | SQUHRBCMXWLYGN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.93 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|