C14H19ClN2O3 — CID 18122851
[2-(cyclohexylmethylamino)-2-oxoethyl] 4-chloro-1H-pyrrole-2-carboxylate (PubChem CID 18122851) has the molecular formula C14H19ClN2O3 and a molecular weight of 298.77 g/mol. Its IUPAC name is [2-(cyclohexylmethylamino)-2-oxoethyl] 4-chloro-1H-pyrrole-2-carboxylate.
| Compound Name | [2-(cyclohexylmethylamino)-2-oxoethyl] 4-chloro-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 18122851 |
| Molecular Formula | C14H19ClN2O3 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | [2-(cyclohexylmethylamino)-2-oxoethyl] 4-chloro-1H-pyrrole-2-carboxylate |
| SMILES | O=C(COC(=O)c1cc(Cl)c[nH]1)NCC1CCCCC1 |
| InChI | InChI=1S/C14H19ClN2O3/c15-11-6-12(16-8-11)14(19)20-9-13(18)17-7-10-4-2-1-3-5-10/h6,8,10,16H,1-5,7,9H2,(H,17,18) |
| InChIKey | SCOCGLFNJDTEDN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |