C17H19ClN4O3S — CID 18124467
6-amino-5-[2-[(5-chlorothiophen-2-yl)methyl-prop-2-enylamino]acetyl]-1-cyclopropylpyrimidine-2,4-dione (PubChem CID 18124467) has the molecular formula C17H19ClN4O3S and a molecular weight of 394.88 g/mol. Its IUPAC name is 6-amino-5-[2-[(5-chlorothiophen-2-yl)methyl-prop-2-enylamino]acetyl]-1-cyclopropylpyrimidine-2,4-dione.
| Compound Name | 6-amino-5-[2-[(5-chlorothiophen-2-yl)methyl-prop-2-enylamino]acetyl]-1-cyclopropylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 18124467 |
| Molecular Formula | C17H19ClN4O3S |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 6-amino-5-[2-[(5-chlorothiophen-2-yl)methyl-prop-2-enylamino]acetyl]-1-cyclopropylpyrimidine-2,4-dione |
| SMILES | C=CCN(CC(=O)c1c(N)n(C2CC2)c(=O)[nH]c1=O)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C17H19ClN4O3S/c1-2-7-21(8-11-5-6-13(18)26-11)9-12(23)14-15(19)22(10-3-4-10)17(25)20-16(14)24/h2,5-6,10H,1,3-4,7-9,19H2,(H,20,24,25) |
| InChIKey | XBQDCQRYNQQKPP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 101.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|