C24H29FN4O2 — CID 18125292
1-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-N-phenylpiperidine-3-carboxamide (PubChem CID 18125292) has the molecular formula C24H29FN4O2 and a molecular weight of 424.52 g/mol. Its IUPAC name is 1-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-N-phenylpiperidine-3-carboxamide.
| Compound Name | 1-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-N-phenylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 18125292 |
| Molecular Formula | C24H29FN4O2 |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | 1-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-N-phenylpiperidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1CCCN(CC(=O)N2CCN(c3ccccc3F)CC2)C1 |
| InChI | InChI=1S/C24H29FN4O2/c25-21-10-4-5-11-22(21)28-13-15-29(16-14-28)23(30)18-27-12-6-7-19(17-27)24(31)26-20-8-2-1-3-9-20/h1-5,8-11,19H,6-7,12-18H2,(H,26,31) |
| InChIKey | DSJFACWTAMDBMK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |