C22H27N5O3 — CID 58985278
(3R)-N-(4-hydroxyphenyl)-1-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]pyrrolidine-3-carboxamide (PubChem CID 58985278) has the molecular formula C22H27N5O3 and a molecular weight of 409.49 g/mol. Its IUPAC name is (3R)-N-(4-hydroxyphenyl)-1-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]pyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-(4-hydroxyphenyl)-1-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 58985278 |
| Molecular Formula | C22H27N5O3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | (3R)-N-(4-hydroxyphenyl)-1-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(O)cc1)[C@@H]1CCN(CC(=O)N2CCN(c3ccccn3)CC2)C1 |
| InChI | InChI=1S/C22H27N5O3/c28-19-6-4-18(5-7-19)24-22(30)17-8-10-25(15-17)16-21(29)27-13-11-26(12-14-27)20-3-1-2-9-23-20/h1-7,9,17,28H,8,10-16H2,(H,24,30)/t17-/m1/s1 |
| InChIKey | XAOIMYKWBVXEOW-QGZVFWFLSA-N |
| XLogP | 1.40 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|