C21H28N6O3 — CID 163589087
(3R)-N-(4-hydroxyanilino)-1-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]pyrrolidin-3-amine oxide (PubChem CID 163589087) has the molecular formula C21H28N6O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is (3R)-N-(4-hydroxyanilino)-1-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]pyrrolidin-3-amine oxide.
| Compound Name | (3R)-N-(4-hydroxyanilino)-1-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]pyrrolidin-3-amine oxide |
|---|---|
| PubChem CID | 163589087 |
| Molecular Formula | C21H28N6O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | (3R)-N-(4-hydroxyanilino)-1-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]pyrrolidin-3-amine oxide |
| SMILES | O=C(CN1CC[C@@H]([NH+]([O-])Nc2ccc(O)cc2)C1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C21H28N6O3/c28-19-6-4-17(5-7-19)23-27(30)18-8-10-24(15-18)16-21(29)26-13-11-25(12-14-26)20-3-1-2-9-22-20/h1-7,9,18,23,27-28H,8,10-16H2/t18-/m1/s1 |
| InChIKey | GNZFYAZEIRSROF-GOSISDBHSA-N |
| XLogP | -0.08 |
| TPSA | 99.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|