C19H21N7S — CID 18125477
N-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)methyl]-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 18125477) has the molecular formula C19H21N7S and a molecular weight of 379.49 g/mol. Its IUPAC name is N-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)methyl]-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)methyl]-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 18125477 |
| Molecular Formula | C19H21N7S |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)methyl]-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1cc(C)n2c(CNc3ncnc4sc5c(c34)CCC(C)C5)nnc2n1 |
| InChI | InChI=1S/C19H21N7S/c1-10-4-5-13-14(6-10)27-18-16(13)17(21-9-22-18)20-8-15-24-25-19-23-11(2)7-12(3)26(15)19/h7,9-10H,4-6,8H2,1-3H3,(H,20,21,22) |
| InChIKey | QEIIIIRLZUBDHW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 80.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |