C21H20N2O5 — CID 18127068
N-[2-hydroxy-2-(4-nitrophenyl)ethyl]-3-(5-phenylfuran-2-yl)propanamide (PubChem CID 18127068) has the molecular formula C21H20N2O5 and a molecular weight of 380.40 g/mol. Its IUPAC name is N-[2-hydroxy-2-(4-nitrophenyl)ethyl]-3-(5-phenylfuran-2-yl)propanamide.
| Compound Name | N-[2-hydroxy-2-(4-nitrophenyl)ethyl]-3-(5-phenylfuran-2-yl)propanamide |
|---|---|
| PubChem CID | 18127068 |
| Molecular Formula | C21H20N2O5 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | N-[2-hydroxy-2-(4-nitrophenyl)ethyl]-3-(5-phenylfuran-2-yl)propanamide |
| SMILES | O=C(CCc1ccc(-c2ccccc2)o1)NCC(O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H20N2O5/c24-19(15-6-8-17(9-7-15)23(26)27)14-22-21(25)13-11-18-10-12-20(28-18)16-4-2-1-3-5-16/h1-10,12,19,24H,11,13-14H2,(H,22,25) |
| InChIKey | XCWCSGFRZZVIPX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|