C18H17N7O2S — CID 18131458
N-[(1-methylimidazol-2-yl)-phenylmethyl]-2-(5-oxo-4-thiophen-2-yltetrazol-1-yl)acetamide (PubChem CID 18131458) has the molecular formula C18H17N7O2S and a molecular weight of 395.45 g/mol. Its IUPAC name is N-[(1-methylimidazol-2-yl)-phenylmethyl]-2-(5-oxo-4-thiophen-2-yltetrazol-1-yl)acetamide.
| Compound Name | N-[(1-methylimidazol-2-yl)-phenylmethyl]-2-(5-oxo-4-thiophen-2-yltetrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 18131458 |
| Molecular Formula | C18H17N7O2S |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | N-[(1-methylimidazol-2-yl)-phenylmethyl]-2-(5-oxo-4-thiophen-2-yltetrazol-1-yl)acetamide |
| SMILES | Cn1ccnc1C(NC(=O)Cn1nnn(-c2cccs2)c1=O)c1ccccc1 |
| InChI | InChI=1S/C18H17N7O2S/c1-23-10-9-19-17(23)16(13-6-3-2-4-7-13)20-14(26)12-24-18(27)25(22-21-24)15-8-5-11-28-15/h2-11,16H,12H2,1H3,(H,20,26) |
| InChIKey | IESLKMTXSVIBGU-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 99.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |