C20H19ClFN3O — CID 18132117
1-[(2-chlorophenyl)methyl]-N-ethyl-N-[(3-fluorophenyl)methyl]pyrazole-4-carboxamide (PubChem CID 18132117) has the molecular formula C20H19ClFN3O and a molecular weight of 371.84 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-N-ethyl-N-[(3-fluorophenyl)methyl]pyrazole-4-carboxamide.
| Compound Name | 1-[(2-chlorophenyl)methyl]-N-ethyl-N-[(3-fluorophenyl)methyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 18132117 |
| Molecular Formula | C20H19ClFN3O |
| Molecular Weight | 371.84 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-N-ethyl-N-[(3-fluorophenyl)methyl]pyrazole-4-carboxamide |
| SMILES | CCN(Cc1cccc(F)c1)C(=O)c1cnn(Cc2ccccc2Cl)c1 |
| InChI | InChI=1S/C20H19ClFN3O/c1-2-24(12-15-6-5-8-18(22)10-15)20(26)17-11-23-25(14-17)13-16-7-3-4-9-19(16)21/h3-11,14H,2,12-13H2,1H3 |
| InChIKey | RNSSWDGIRFYALY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.84 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |